About 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate
3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 170907013) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate |
| PubChem CID | 170907013 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C1C[C@H](CCCOC(=O)C(C)(C)C)O[C@H]1CCCO |
| InChI | InChI=1S/C16H28O4/c1-12-11-13(20-14(12)8-5-9-17)7-6-10-19-15(18)16(2,3)4/h13-14,17H,1,5-11H2,2-4H3/t13-,14-/m0/s1 |
| InChIKey | LNYGNRLPWARUAP-KBPBESRZSA-N |
| XLogP | 2.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate?
The IUPAC name of 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate (CID 170907013) is 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate.
What is the SMILES notation for 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate?
The canonical SMILES for 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate is C=C1C[C@H](CCCOC(=O)C(C)(C)C)O[C@H]1CCCO.
What is the InChIKey of 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate?
The InChIKey is LNYGNRLPWARUAP-KBPBESRZSA-N. The full InChI is InChI=1S/C16H28O4/c1-12-11-13(20-14(12)8-5-9-17)7-6-10-19-15(18)16(2,3)4/h13-14,17H,1,5-11H2,2-4H3/t13-,14-/m0/s1.
What are the key properties of 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate?
3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate has a molecular weight of 284.40 g/mol, XLogP of 2.84, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,5S)-5-(3-hydroxypropyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate is sourced from PubChem (CID 170907013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).