About ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride
ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride (PubChem CID 170907106) has the molecular formula C12H19ClN2O2S
and a molecular weight of 290.82 g/mol. Its IUPAC name is ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride |
| PubChem CID | 170907106 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1sc(C2CCNCC2)nc1C.Cl |
| InChI | InChI=1S/C12H18N2O2S.ClH/c1-3-16-12(15)10-8(2)14-11(17-10)9-4-6-13-7-5-9;/h9,13H,3-7H2,1-2H3;1H |
| InChIKey | XTMAGBZZOMJKAC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride?
The IUPAC name of ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride (CID 170907106) is ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride?
The canonical SMILES for ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride is CCOC(=O)c1sc(C2CCNCC2)nc1C.Cl.
What is the InChIKey of ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride?
The InChIKey is XTMAGBZZOMJKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2S.ClH/c1-3-16-12(15)10-8(2)14-11(17-10)9-4-6-13-7-5-9;/h9,13H,3-7H2,1-2H3;1H.
What are the key properties of ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride?
ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride has a molecular weight of 290.82 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methyl-2-piperidin-4-yl-1,3-thiazole-5-carboxylate;hydrochloride is sourced from PubChem (CID 170907106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).