C54H32FeP2-10 — CID 170907168
bis(13-cyclopenta-2,4-dien-1-yl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene);iron (PubChem CID 170907168) has the molecular formula C54H32FeP2-10 and a molecular weight of 798.64 g/mol. Its IUPAC name is bis(13-cyclopenta-2,4-dien-1-yl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene);iron.
| Compound Name | bis(13-cyclopenta-2,4-dien-1-yl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene);iron |
|---|---|
| PubChem CID | 170907168 |
| Molecular Formula | C54H32FeP2-10 |
| Molecular Weight | 798.64 g/mol |
| Exact Mass | 798.14 |
| IUPAC Name | bis(13-cyclopenta-2,4-dien-1-yl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene);iron |
| SMILES | [Fe].[c-]1[c-][c-][c-](P2Cc3ccc4ccccc4c3-c3c(ccc4ccccc34)C2)[c-]1.[c-]1[c-][c-][c-](P2Cc3ccc4ccccc4c3-c3c(ccc4ccccc34)C2)[c-]1 |
| InChI | InChI=1S/2C27H16P.Fe/c2*1-5-11-24-19(7-1)13-15-21-17-28(23-9-3-4-10-23)18-22-16-14-20-8-2-6-12-25(20)27(22)26(21)24;/h2*1-2,5-8,11-16H,17-18H2;/q2*-5; |
| InChIKey | KCPZRNRBFQDNBD-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.64 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|