C11H15F3N4O4 — CID 170907284
ethyl 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 170907284) has the molecular formula C11H15F3N4O4 and a molecular weight of 324.26 g/mol. Its IUPAC name is ethyl 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170907284 |
| Molecular Formula | C11H15F3N4O4 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | ethyl 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1nnc2n1CCNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H14N4O2.C2HF3O2/c1-2-15-9(14)8-12-11-7-3-4-10-5-6-13(7)8;3-2(4,5)1(6)7/h10H,2-6H2,1H3;(H,6,7) |
| InChIKey | FSLOTIXLJNWXOP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |