About 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide
4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide (PubChem CID 170907700) has the molecular formula C7H13N3O3S
and a molecular weight of 219.27 g/mol. Its IUPAC name is 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide.
Molecular Properties
| Compound Name | 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide |
| PubChem CID | 170907700 |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide |
| SMILES | CCOc1cnn(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C7H13N3O3S/c1-4-13-7-5-8-10(6-7)14(11,12)9(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | PLHUXEIFOLLSFC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide?
The IUPAC name of 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide (CID 170907700) is 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide.
What is the SMILES notation for 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide?
The canonical SMILES for 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide is CCOc1cnn(S(=O)(=O)N(C)C)c1.
What is the InChIKey of 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide?
The InChIKey is PLHUXEIFOLLSFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O3S/c1-4-13-7-5-8-10(6-7)14(11,12)9(2)3/h5-6H,4H2,1-3H3.
What are the key properties of 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide?
4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide has a molecular weight of 219.27 g/mol, XLogP of -0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide is sourced from PubChem (CID 170907700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).