C23H19NO4 — CID 170907734
5-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)benzene-1,3-dicarbaldehyde (PubChem CID 170907734) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 5-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 170907734 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 5-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C=O)cc(-c2cc(=O)oc3c4c5c(cc23)CCCN5CCC4)c1 |
| InChI | InChI=1S/C23H19NO4/c25-12-14-7-15(13-26)9-17(8-14)19-11-21(27)28-23-18-4-2-6-24-5-1-3-16(22(18)24)10-20(19)23/h7-13H,1-6H2 |
| InChIKey | GZFSQPOLKQOOGD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|