C14H23NO5 — CID 170907920
[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate (PubChem CID 170907920) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate.
| Compound Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 170907920 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxabicyclo[2.2.1]heptan-1-yl]methyl acetate |
| SMILES | CC(=O)OCC12CCC(NC(=O)OC(C)(C)C)(CO1)C2 |
| InChI | InChI=1S/C14H23NO5/c1-10(16)18-9-14-6-5-13(7-14,8-19-14)15-11(17)20-12(2,3)4/h5-9H2,1-4H3,(H,15,17) |
| InChIKey | YPDMGVPJVTVDJD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |