C19H32N6O2 — CID 170908255
1-[[2,2-dimethyl-3-(2,3,4,5-tetrahydropyridin-6-ylcarbamoylamino)cyclobutyl]methyl]-3-(2,3,4,5-tetrahydropyridin-6-yl)urea (PubChem CID 170908255) has the molecular formula C19H32N6O2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-[[2,2-dimethyl-3-(2,3,4,5-tetrahydropyridin-6-ylcarbamoylamino)cyclobutyl]methyl]-3-(2,3,4,5-tetrahydropyridin-6-yl)urea.
| Compound Name | 1-[[2,2-dimethyl-3-(2,3,4,5-tetrahydropyridin-6-ylcarbamoylamino)cyclobutyl]methyl]-3-(2,3,4,5-tetrahydropyridin-6-yl)urea |
|---|---|
| PubChem CID | 170908255 |
| Molecular Formula | C19H32N6O2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 1-[[2,2-dimethyl-3-(2,3,4,5-tetrahydropyridin-6-ylcarbamoylamino)cyclobutyl]methyl]-3-(2,3,4,5-tetrahydropyridin-6-yl)urea |
| SMILES | CC1(C)C(CNC(=O)NC2=NCCCC2)CC1NC(=O)NC1=NCCCC1 |
| InChI | InChI=1S/C19H32N6O2/c1-19(2)13(12-22-17(26)24-15-7-3-5-9-20-15)11-14(19)23-18(27)25-16-8-4-6-10-21-16/h13-14H,3-12H2,1-2H3,(H2,20,22,24,26)(H2,21,23,25,27) |
| InChIKey | FZWAFIIXBCBZJB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |