C17H24N2O2 — CID 170908371
2-(3-acetamido-2,2-dimethylcyclobutyl)-N-(2-methylphenyl)acetamide (PubChem CID 170908371) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(3-acetamido-2,2-dimethylcyclobutyl)-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(3-acetamido-2,2-dimethylcyclobutyl)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 170908371 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-(3-acetamido-2,2-dimethylcyclobutyl)-N-(2-methylphenyl)acetamide |
| SMILES | CC(=O)NC1CC(CC(=O)Nc2ccccc2C)C1(C)C |
| InChI | InChI=1S/C17H24N2O2/c1-11-7-5-6-8-14(11)19-16(21)10-13-9-15(17(13,3)4)18-12(2)20/h5-8,13,15H,9-10H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | SVIFIQNLCREFBC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |