About methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate
methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate (PubChem CID 170908435) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 170908435 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(NC2=CC(=O)CC(C)(C)C2)C(N)C=C1 |
| InChI | InChI=1S/C16H22N2O3/c1-16(2)8-11(7-12(19)9-16)18-14-6-10(15(20)21-3)4-5-13(14)17/h4-7,13-14,18H,8-9,17H2,1-3H3 |
| InChIKey | HXPRBZOKCIADNU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate (CID 170908435) is methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=CC(NC2=CC(=O)CC(C)(C)C2)C(N)C=C1.
What is the InChIKey of methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate?
The InChIKey is HXPRBZOKCIADNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-16(2)8-11(7-12(19)9-16)18-14-6-10(15(20)21-3)4-5-13(14)17/h4-7,13-14,18H,8-9,17H2,1-3H3.
What are the key properties of methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate?
methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate has a molecular weight of 290.36 g/mol, XLogP of 1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]cyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 170908435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).