About 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one
3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 170908436) has the molecular formula C15H19F3N2O
and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 170908436 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C=C(NC2C=C(C(F)(F)F)C=CC2N)C1 |
| InChI | InChI=1S/C15H19F3N2O/c1-14(2)7-10(6-11(21)8-14)20-13-5-9(15(16,17)18)3-4-12(13)19/h3-6,12-13,20H,7-8,19H2,1-2H3 |
| InChIKey | VBPFHTQGROIFBZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one (CID 170908436) is 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one is CC1(C)CC(=O)C=C(NC2C=C(C(F)(F)F)C=CC2N)C1.
What is the InChIKey of 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one?
The InChIKey is VBPFHTQGROIFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3N2O/c1-14(2)7-10(6-11(21)8-14)20-13-5-9(15(16,17)18)3-4-12(13)19/h3-6,12-13,20H,7-8,19H2,1-2H3.
What are the key properties of 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one?
3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one has a molecular weight of 300.32 g/mol, XLogP of 2.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]amino]-5,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 170908436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).