C11H13N3S — CID 170909236
3-benzyl-5-methyl-6H-1,3,4-thiadiazin-2-imine (PubChem CID 170909236) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-benzyl-5-methyl-6H-1,3,4-thiadiazin-2-imine.
| Compound Name | 3-benzyl-5-methyl-6H-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 170909236 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-benzyl-5-methyl-6H-1,3,4-thiadiazin-2-imine |
| SMILES | [H]/N=C1\SCC(C)=NN1Cc1ccccc1 |
| InChI | InChI=1S/C11H13N3S/c1-9-8-15-11(12)14(13-9)7-10-5-3-2-4-6-10/h2-6,12H,7-8H2,1H3/b12-11- |
| InChIKey | PAGQIQHPJALJKS-QXMHVHEDSA-N |
| XLogP | 2.55 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|