C19H22N2O2 — CID 170909478
2,3-dimethyl-5-[4-(2-methylphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 170909478) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2,3-dimethyl-5-[4-(2-methylphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethyl-5-[4-(2-methylphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 170909478 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2,3-dimethyl-5-[4-(2-methylphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(N2CCN(c3ccccc3C)CC2)=CC1=O |
| InChI | InChI=1S/C19H22N2O2/c1-13-6-4-5-7-16(13)20-8-10-21(11-9-20)17-12-18(22)14(2)15(3)19(17)23/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | PAYBLRZFNDNLDL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|