C8H11IN2O — CID 170910133
3-iodo-6,6-dimethyl-4,7-dihydro-1H-pyrano[4,3-c]pyrazole (PubChem CID 170910133) has the molecular formula C8H11IN2O and a molecular weight of 278.09 g/mol. Its IUPAC name is 3-iodo-6,6-dimethyl-4,7-dihydro-1H-pyrano[4,3-c]pyrazole.
| Compound Name | 3-iodo-6,6-dimethyl-4,7-dihydro-1H-pyrano[4,3-c]pyrazole |
|---|---|
| PubChem CID | 170910133 |
| Molecular Formula | C8H11IN2O |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 3-iodo-6,6-dimethyl-4,7-dihydro-1H-pyrano[4,3-c]pyrazole |
| SMILES | CC1(C)Cc2[nH]nc(I)c2CO1 |
| InChI | InChI=1S/C8H11IN2O/c1-8(2)3-6-5(4-12-8)7(9)11-10-6/h3-4H2,1-2H3,(H,10,11) |
| InChIKey | COQWWSFCLBUQCU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|