About 4-chloroquinoline-5,7-diol
4-chloroquinoline-5,7-diol (PubChem CID 170910283) has the molecular formula C9H6ClNO2
and a molecular weight of 195.61 g/mol. Its IUPAC name is 4-chloroquinoline-5,7-diol.
Molecular Properties
| Compound Name | 4-chloroquinoline-5,7-diol |
| PubChem CID | 170910283 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 4-chloroquinoline-5,7-diol |
| SMILES | Oc1cc(O)c2c(Cl)ccnc2c1 |
| InChI | InChI=1S/C9H6ClNO2/c10-6-1-2-11-7-3-5(12)4-8(13)9(6)7/h1-4,12-13H |
| InChIKey | SJUKARODRSOJRM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloroquinoline-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroquinoline-5,7-diol?
The IUPAC name of 4-chloroquinoline-5,7-diol (CID 170910283) is 4-chloroquinoline-5,7-diol.
What is the SMILES notation for 4-chloroquinoline-5,7-diol?
The canonical SMILES for 4-chloroquinoline-5,7-diol is Oc1cc(O)c2c(Cl)ccnc2c1.
What is the InChIKey of 4-chloroquinoline-5,7-diol?
The InChIKey is SJUKARODRSOJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2/c10-6-1-2-11-7-3-5(12)4-8(13)9(6)7/h1-4,12-13H.
What are the key properties of 4-chloroquinoline-5,7-diol?
4-chloroquinoline-5,7-diol has a molecular weight of 195.61 g/mol, XLogP of 2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroquinoline-5,7-diol is sourced from PubChem (CID 170910283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).