About 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride
2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride (PubChem CID 170911905) has the molecular formula C12H21Cl3N4O
and a molecular weight of 343.69 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride.
Molecular Properties
| Compound Name | 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride |
| PubChem CID | 170911905 |
| Molecular Formula | C12H21Cl3N4O |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride |
| SMILES | CN(C)CCOc1cccc2[nH]c(CN)nc12.Cl.Cl.Cl |
| InChI | InChI=1S/C12H18N4O.3ClH/c1-16(2)6-7-17-10-5-3-4-9-12(10)15-11(8-13)14-9;;;/h3-5H,6-8,13H2,1-2H3,(H,14,15);3*1H |
| InChIKey | JZJCFINDPPSQIN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride?
The IUPAC name of 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride (CID 170911905) is 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride.
What is the SMILES notation for 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride?
The canonical SMILES for 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride is CN(C)CCOc1cccc2[nH]c(CN)nc12.Cl.Cl.Cl.
What is the InChIKey of 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride?
The InChIKey is JZJCFINDPPSQIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O.3ClH/c1-16(2)6-7-17-10-5-3-4-9-12(10)15-11(8-13)14-9;;;/h3-5H,6-8,13H2,1-2H3,(H,14,15);3*1H.
What are the key properties of 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride?
2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride has a molecular weight of 343.69 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(aminomethyl)-1H-benzimidazol-4-yl]oxy]-N,N-dimethylethanamine;trihydrochloride is sourced from PubChem (CID 170911905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).