About 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride
1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride (PubChem CID 170912839) has the molecular formula C9H9ClO4S2
and a molecular weight of 280.75 g/mol. Its IUPAC name is 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride |
| PubChem CID | 170912839 |
| Molecular Formula | C9H9ClO4S2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)CCCS2(=O)=O |
| InChI | InChI=1S/C9H9ClO4S2/c10-16(13,14)8-3-4-9-7(6-8)2-1-5-15(9,11)12/h3-4,6H,1-2,5H2 |
| InChIKey | HXKAYUBCJSGYGD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride?
The IUPAC name of 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride (CID 170912839) is 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride.
What is the SMILES notation for 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride?
The canonical SMILES for 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride is O=S(=O)(Cl)c1ccc2c(c1)CCCS2(=O)=O.
What is the InChIKey of 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride?
The InChIKey is HXKAYUBCJSGYGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO4S2/c10-16(13,14)8-3-4-9-7(6-8)2-1-5-15(9,11)12/h3-4,6H,1-2,5H2.
What are the key properties of 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride?
1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride has a molecular weight of 280.75 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-3,4-dihydro-2H-thiochromene-6-sulfonyl chloride is sourced from PubChem (CID 170912839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).