C25H17F3N2O6 — CID 170913247
ethyl 3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 170913247) has the molecular formula C25H17F3N2O6 and a molecular weight of 498.41 g/mol. Its IUPAC name is ethyl 3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | ethyl 3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 170913247 |
| Molecular Formula | C25H17F3N2O6 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | ethyl 3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | CCOC(=O)C1N=C(C2C(=O)c3ccccc3C2=O)C2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)C12 |
| InChI | InChI=1S/C25H17F3N2O6/c1-2-36-24(35)19-16-15(18(29-19)17-20(31)13-8-3-4-9-14(13)21(17)32)22(33)30(23(16)34)12-7-5-6-11(10-12)25(26,27)28/h3-10,15-17,19H,2H2,1H3 |
| InChIKey | YCXVOVPZKRGEPW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|