About N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine
N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 170913490) has the molecular formula C14H16N4O3S
and a molecular weight of 320.37 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine |
| PubChem CID | 170913490 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Cc1cn2c(NC(C)(C)C)c(-c3ccc([N+](=O)[O-])o3)nc2s1 |
| InChI | InChI=1S/C14H16N4O3S/c1-8-7-17-12(16-14(2,3)4)11(15-13(17)22-8)9-5-6-10(21-9)18(19)20/h5-7,16H,1-4H3 |
| InChIKey | ZFAWWHLZZAAVOG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine?
The IUPAC name of N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine (CID 170913490) is N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine.
What is the SMILES notation for N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine?
The canonical SMILES for N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine is Cc1cn2c(NC(C)(C)C)c(-c3ccc([N+](=O)[O-])o3)nc2s1.
What is the InChIKey of N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine?
The InChIKey is ZFAWWHLZZAAVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O3S/c1-8-7-17-12(16-14(2,3)4)11(15-13(17)22-8)9-5-6-10(21-9)18(19)20/h5-7,16H,1-4H3.
What are the key properties of N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine?
N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine has a molecular weight of 320.37 g/mol, XLogP of 4.08, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-methyl-6-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]thiazol-5-amine is sourced from PubChem (CID 170913490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).