C4H9Cl2F5N2 — CID 170914154
3,3,4,4,4-pentafluorobutylhydrazine;dihydrochloride (PubChem CID 170914154) has the molecular formula C4H9Cl2F5N2 and a molecular weight of 251.03 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutylhydrazine;dihydrochloride.
| Compound Name | 3,3,4,4,4-pentafluorobutylhydrazine;dihydrochloride |
|---|---|
| PubChem CID | 170914154 |
| Molecular Formula | C4H9Cl2F5N2 |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutylhydrazine;dihydrochloride |
| SMILES | Cl.Cl.NNCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H7F5N2.2ClH/c5-3(6,1-2-11-10)4(7,8)9;;/h11H,1-2,10H2;2*1H |
| InChIKey | MFBXZWHNCMRWDO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|