About methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate
methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate (PubChem CID 170914501) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate |
| PubChem CID | 170914501 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1cc2cc[nH]c2nn1 |
| InChI | InChI=1S/C8H7N3O2/c1-13-8(12)6-4-5-2-3-9-7(5)11-10-6/h2-4H,1H3,(H,9,11) |
| InChIKey | HOYKPMFJRSFYRS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
The IUPAC name of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate (CID 170914501) is methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate.
What is the SMILES notation for methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
The canonical SMILES for methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate is COC(=O)c1cc2cc[nH]c2nn1.
What is the InChIKey of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
The InChIKey is HOYKPMFJRSFYRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-13-8(12)6-4-5-2-3-9-7(5)11-10-6/h2-4H,1H3,(H,9,11).
What are the key properties of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate has a molecular weight of 177.16 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate is sourced from PubChem (CID 170914501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).