methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate

C8H7N3O2 — CID 170914501

IUPACmethyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate
SMILESCOC(=O)c1cc2cc[nH]c2nn1
InChIInChI=1S/C8H7N3O2/c1-13-8(12)6-4-5-2-3-9-7(5)11-10-6/h2-4H,1H3,(H,9,11)
InChIKeyHOYKPMFJRSFYRS-UHFFFAOYSA-N
MW177.16 g/mol
LogP0.74
Rot. Bonds1

About methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate

methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate (PubChem CID 170914501) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate.

Molecular Properties

Compound Namemethyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate
PubChem CID170914501
Molecular FormulaC8H7N3O2
Molecular Weight177.16 g/mol
Exact Mass177.05
IUPAC Namemethyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate
SMILESCOC(=O)c1cc2cc[nH]c2nn1
InChIInChI=1S/C8H7N3O2/c1-13-8(12)6-4-5-2-3-9-7(5)11-10-6/h2-4H,1H3,(H,9,11)
InChIKeyHOYKPMFJRSFYRS-UHFFFAOYSA-N
XLogP0.74
TPSA67.87 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
The IUPAC name of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate (CID 170914501) is methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate.
What is the SMILES notation for methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
The canonical SMILES for methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate is COC(=O)c1cc2cc[nH]c2nn1.
What is the InChIKey of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
The InChIKey is HOYKPMFJRSFYRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-13-8(12)6-4-5-2-3-9-7(5)11-10-6/h2-4H,1H3,(H,9,11).
What are the key properties of methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate?
methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate has a molecular weight of 177.16 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7H-pyrrolo[2,3-c]pyridazine-3-carboxylate is sourced from PubChem (CID 170914501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).