About methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate
methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate (PubChem CID 170914899) has the molecular formula C11H9ClN2O3
and a molecular weight of 252.66 g/mol. Its IUPAC name is methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate |
| PubChem CID | 170914899 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate |
| SMILES | COC(=O)Cc1noc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C11H9ClN2O3/c1-16-10(15)6-9-13-11(17-14-9)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3 |
| InChIKey | ZCEOFEFRUROUFH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate?
The IUPAC name of methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate (CID 170914899) is methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate.
What is the SMILES notation for methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate?
The canonical SMILES for methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate is COC(=O)Cc1noc(-c2ccccc2Cl)n1.
What is the InChIKey of methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate?
The InChIKey is ZCEOFEFRUROUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O3/c1-16-10(15)6-9-13-11(17-14-9)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3.
What are the key properties of methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate?
methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate has a molecular weight of 252.66 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]acetate is sourced from PubChem (CID 170914899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).