About [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine
[3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine (PubChem CID 170915483) has the molecular formula C9H9F4N
and a molecular weight of 207.17 g/mol. Its IUPAC name is [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine.
Analyze [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine?
The IUPAC name of [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine (CID 170915483) is [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine.
What is the SMILES notation for [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine?
The canonical SMILES for [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine is NCc1ccc(CC(F)(F)F)c(F)c1.
What is the InChIKey of [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine?
The InChIKey is OEMMNLMHKYVYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F4N/c10-8-3-6(5-14)1-2-7(8)4-9(11,12)13/h1-3H,4-5,14H2.
What are the key properties of [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine?
[3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine has a molecular weight of 207.17 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]methanamine is sourced from PubChem (CID 170915483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).