4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid

C12H15NO2 — CID 170916024

IUPAC4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid
SMILESCC1(C)CCNc2c(C(=O)O)cccc21
InChIInChI=1S/C12H15NO2/c1-12(2)6-7-13-10-8(11(14)15)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3,(H,14,15)
InChIKeyWQCOYNHMIKZQJT-UHFFFAOYSA-N
MW205.26 g/mol
LogP2.48
Rot. Bonds1

About 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid

4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid (PubChem CID 170916024) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid.

Molecular Properties

Compound Name4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid
PubChem CID170916024
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Name4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid
SMILESCC1(C)CCNc2c(C(=O)O)cccc21
InChIInChI=1S/C12H15NO2/c1-12(2)6-7-13-10-8(11(14)15)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3,(H,14,15)
InChIKeyWQCOYNHMIKZQJT-UHFFFAOYSA-N
XLogP2.48
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 52.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid?
The IUPAC name of 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid (CID 170916024) is 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid.
What is the SMILES notation for 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid?
The canonical SMILES for 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid is CC1(C)CCNc2c(C(=O)O)cccc21.
What is the InChIKey of 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid?
The InChIKey is WQCOYNHMIKZQJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-12(2)6-7-13-10-8(11(14)15)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3,(H,14,15).
What are the key properties of 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid?
4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid has a molecular weight of 205.26 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2,3-dihydro-1H-quinoline-8-carboxylic acid is sourced from PubChem (CID 170916024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).