About 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol
2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol (PubChem CID 170916328) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol |
| PubChem CID | 170916328 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol |
| SMILES | CC(C)(O)C1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C8H15NO/c1-8(2,10)7-5-3-9-4-6(5)7/h5-7,9-10H,3-4H2,1-2H3/t5-,6+,7? |
| InChIKey | MGYYNDGUQYDYDS-MEKDEQNOSA-N |
| XLogP | 0.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol?
The IUPAC name of 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol (CID 170916328) is 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol.
What is the SMILES notation for 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol?
The canonical SMILES for 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol is CC(C)(O)C1[C@H]2CNC[C@@H]12.
What is the InChIKey of 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol?
The InChIKey is MGYYNDGUQYDYDS-MEKDEQNOSA-N. The full InChI is InChI=1S/C8H15NO/c1-8(2,10)7-5-3-9-4-6(5)7/h5-7,9-10H,3-4H2,1-2H3/t5-,6+,7?.
What are the key properties of 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol?
2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol has a molecular weight of 141.21 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]propan-2-ol is sourced from PubChem (CID 170916328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).