C39H73N5O13 — CID 170919522
3-[2-[2-[2-[2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 170919522) has the molecular formula C39H73N5O13 and a molecular weight of 820.03 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 170919522 |
| Molecular Formula | C39H73N5O13 |
| Molecular Weight | 820.03 g/mol |
| Exact Mass | 819.52 |
| IUPAC Name | 3-[2-[2-[2-[2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)NCCOCCOCCOCCOCCC(=O)O)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C39H73N5O13/c1-37(2,3)55-34(48)29-42-14-12-41(28-32(45)40-11-21-52-23-25-54-27-26-53-24-22-51-20-10-33(46)47)13-15-43(30-35(49)56-38(4,5)6)17-19-44(18-16-42)31-36(50)57-39(7,8)9/h10-31H2,1-9H3,(H,40,45)(H,46,47) |
| InChIKey | DVLNWRVWROYTNV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 195.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.03 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|