About 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol
2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 170919643) has the molecular formula C7H5BrN2O
and a molecular weight of 213.03 g/mol. Its IUPAC name is 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol |
| PubChem CID | 170919643 |
| Molecular Formula | C7H5BrN2O |
| Molecular Weight | 213.03 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | Oc1[nH]cc2nc(Br)ccc12 |
| InChI | InChI=1S/C7H5BrN2O/c8-6-2-1-4-5(10-6)3-9-7(4)11/h1-3,9,11H |
| InChIKey | AULGVTABPYYCIU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.03 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol?
The IUPAC name of 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol (CID 170919643) is 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol.
What is the SMILES notation for 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol?
The canonical SMILES for 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol is Oc1[nH]cc2nc(Br)ccc12.
What is the InChIKey of 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol?
The InChIKey is AULGVTABPYYCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2O/c8-6-2-1-4-5(10-6)3-9-7(4)11/h1-3,9,11H.
What are the key properties of 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol?
2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol has a molecular weight of 213.03 g/mol, XLogP of 2.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6H-pyrrolo[3,4-b]pyridin-5-ol is sourced from PubChem (CID 170919643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).