C37H9F15N4 — CID 170920513
5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22H-corrin (PubChem CID 170920513) has the molecular formula C37H9F15N4 and a molecular weight of 794.48 g/mol. Its IUPAC name is 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22H-corrin.
| Compound Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22H-corrin |
|---|---|
| PubChem CID | 170920513 |
| Molecular Formula | C37H9F15N4 |
| Molecular Weight | 794.48 g/mol |
| Exact Mass | 794.06 |
| IUPAC Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-22H-corrin |
| SMILES | Fc1c(F)c(F)c(/C2=C3\C=CC(=N3)/C(c3c(F)c(F)c(F)c(F)c3F)=c3/cc/c([nH]3)=C(\c3c(F)c(F)c(F)c(F)c3F)C3=N/C(=C4/C=CC2=N4)C=C3)c(F)c1F |
| InChI | InChI=1S/C37H9F15N4/c38-23-20(24(39)30(45)35(50)29(23)44)17-11-3-1-9(53-11)10-2-4-12(54-10)18(21-25(40)31(46)36(51)32(47)26(21)41)14-6-8-16(56-14)19(15-7-5-13(17)55-15)22-27(42)33(48)37(52)34(49)28(22)43/h1-8,55H/b10-9-,17-11+,17-13+,18-12+,18-14+,19-15+,19-16+ |
| InChIKey | SNTSHLPHJRPUDE-IXCVTHGBSA-N |
| XLogP | 8.17 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.48 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|