C18H22N2O6 — CID 170921131
prop-2-enyl 4-methyl-2-oxo-6-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 170921131) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-oxo-6-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-oxo-6-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 170921131 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | prop-2-enyl 4-methyl-2-oxo-6-(3,4,5-trimethoxyphenyl)-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)C1C(C)=NC(=O)NC1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H22N2O6/c1-6-7-26-17(21)14-10(2)19-18(22)20-15(14)11-8-12(23-3)16(25-5)13(9-11)24-4/h6,8-9,14-15H,1,7H2,2-5H3,(H,20,22) |
| InChIKey | UERCZZPSGKEBOA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|