C20H22N4O2 — CID 170921516
6,6-dimethyl-9-(4-prop-2-enoxyphenyl)-5,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 170921516) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6,6-dimethyl-9-(4-prop-2-enoxyphenyl)-5,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 6,6-dimethyl-9-(4-prop-2-enoxyphenyl)-5,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 170921516 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 6,6-dimethyl-9-(4-prop-2-enoxyphenyl)-5,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | C=CCOc1ccc(C2C3C(=O)CC(C)(C)CC3=Nc3ncnn32)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-4-9-26-14-7-5-13(6-8-14)18-17-15(10-20(2,3)11-16(17)25)23-19-21-12-22-24(18)19/h4-8,12,17-18H,1,9-11H2,2-3H3 |
| InChIKey | TUSCDVLUMVTCNB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|