C20H17N3O4S — CID 170921532
(4R,7S)-4-(3,4-dihydroxyphenyl)-7-thiophen-2-yl-2,4,4a,6,7,8-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 170921532) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is (4R,7S)-4-(3,4-dihydroxyphenyl)-7-thiophen-2-yl-2,4,4a,6,7,8-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4R,7S)-4-(3,4-dihydroxyphenyl)-7-thiophen-2-yl-2,4,4a,6,7,8-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 170921532 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (4R,7S)-4-(3,4-dihydroxyphenyl)-7-thiophen-2-yl-2,4,4a,6,7,8-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | O=C1C[C@@H](c2cccs2)CC2=Nc3[nH][nH]c(=O)c3[C@@H](c3ccc(O)c(O)c3)C12 |
| InChI | InChI=1S/C20H17N3O4S/c24-12-4-3-9(7-13(12)25)16-17-11(21-19-18(16)20(27)23-22-19)6-10(8-14(17)26)15-2-1-5-28-15/h1-5,7,10,16-17,24-25H,6,8H2,(H2,22,23,27)/t10-,16-,17?/m0/s1 |
| InChIKey | CAUFRQWLBYAEMG-BXSMUCOKSA-N |
| XLogP | 3.16 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|