C13H12F6O5 — CID 170923102
ethyl 4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylate (PubChem CID 170923102) has the molecular formula C13H12F6O5 and a molecular weight of 362.22 g/mol. Its IUPAC name is ethyl 4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 170923102 |
| Molecular Formula | C13H12F6O5 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | ethyl 4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(=C(O)C(F)(F)F)C(=O)C(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H12F6O5/c1-2-24-11(23)5-3-6(9(21)12(14,15)16)8(20)7(4-5)10(22)13(17,18)19/h5-6,22H,2-4H2,1H3 |
| InChIKey | GSPHPPJGVIGHAG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|