C2H3N3OS — CID 170923467
3-sulfanyl-3,4-dihydro-1,2,4-triazol-5-one (PubChem CID 170923467) has the molecular formula C2H3N3OS and a molecular weight of 117.13 g/mol. Its IUPAC name is 3-sulfanyl-3,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-sulfanyl-3,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 170923467 |
| Molecular Formula | C2H3N3OS |
| Molecular Weight | 117.13 g/mol |
| Exact Mass | 117.00 |
| IUPAC Name | 3-sulfanyl-3,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=C1N=NC(S)N1 |
| InChI | InChI=1S/C2H3N3OS/c6-1-3-2(7)5-4-1/h2,7H,(H,3,6) |
| InChIKey | AUFONYCXTNDBNR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.13 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|