C14H15F7O5 — CID 170924192
trans-(1S,3R)-1-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid (PubChem CID 170924192) has the molecular formula C14H15F7O5 and a molecular weight of 396.26 g/mol. Its IUPAC name is trans-(1S,3R)-1-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid.
| Compound Name | trans-(1S,3R)-1-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 170924192 |
| Molecular Formula | C14H15F7O5 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | trans-(1S,3R)-1-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid |
| SMILES | CC1(C)[C@](C(=O)O)(C(=O)C(F)(F)C(F)(F)C(F)(F)F)CC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C14H15F7O5/c1-9(2)10(3,7(23)24)4-5-11(9,8(25)26)6(22)12(15,16)13(17,18)14(19,20)21/h4-5H2,1-3H3,(H,23,24)(H,25,26)/t10-,11-/m0/s1 |
| InChIKey | HRXSXNPGBHFQLM-QWRGUYRKSA-N |
| XLogP | 3.37 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|