C31H36 — CID 170924915
2'-(3,5-ditert-butylphenyl)spiro[cyclopentane-1,9'-fluorene] (PubChem CID 170924915) has the molecular formula C31H36 and a molecular weight of 408.63 g/mol. Its IUPAC name is 2'-(3,5-ditert-butylphenyl)spiro[cyclopentane-1,9'-fluorene].
| Compound Name | 2'-(3,5-ditert-butylphenyl)spiro[cyclopentane-1,9'-fluorene] |
|---|---|
| PubChem CID | 170924915 |
| Molecular Formula | C31H36 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2'-(3,5-ditert-butylphenyl)spiro[cyclopentane-1,9'-fluorene] |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)C2(CCCC2)c2ccccc2-3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H36/c1-29(2,3)23-17-22(18-24(20-23)30(4,5)6)21-13-14-26-25-11-7-8-12-27(25)31(28(26)19-21)15-9-10-16-31/h7-8,11-14,17-20H,9-10,15-16H2,1-6H3 |
| InChIKey | ZOMOQTRISXZETD-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |