C17H14Cl2FN5OS2 — CID 170925299
4-[5-[5-[(2,6-dichloro-3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrazin-2-yl]morpholine (PubChem CID 170925299) has the molecular formula C17H14Cl2FN5OS2 and a molecular weight of 458.37 g/mol. Its IUPAC name is 4-[5-[5-[(2,6-dichloro-3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrazin-2-yl]morpholine.
| Compound Name | 4-[5-[5-[(2,6-dichloro-3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrazin-2-yl]morpholine |
|---|---|
| PubChem CID | 170925299 |
| Molecular Formula | C17H14Cl2FN5OS2 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | 4-[5-[5-[(2,6-dichloro-3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrazin-2-yl]morpholine |
| SMILES | Fc1ccc(Cl)c(CSc2nnc(-c3cnc(N4CCOCC4)cn3)s2)c1Cl |
| InChI | InChI=1S/C17H14Cl2FN5OS2/c18-11-1-2-12(20)15(19)10(11)9-27-17-24-23-16(28-17)13-7-22-14(8-21-13)25-3-5-26-6-4-25/h1-2,7-8H,3-6,9H2 |
| InChIKey | FOCBQVVJMXRKBA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|