C18H30O2 — CID 170925457
(1S,11S)-6-ethyl-2,2,10,10-tetramethyl-5,7-dioxatetracyclo[9.2.1.01,9.04,8]tetradecane (PubChem CID 170925457) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (1S,11S)-6-ethyl-2,2,10,10-tetramethyl-5,7-dioxatetracyclo[9.2.1.01,9.04,8]tetradecane.
| Compound Name | (1S,11S)-6-ethyl-2,2,10,10-tetramethyl-5,7-dioxatetracyclo[9.2.1.01,9.04,8]tetradecane |
|---|---|
| PubChem CID | 170925457 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (1S,11S)-6-ethyl-2,2,10,10-tetramethyl-5,7-dioxatetracyclo[9.2.1.01,9.04,8]tetradecane |
| SMILES | CCC1OC2CC(C)(C)[C@@]34CC[C@@H](C3)C(C)(C)C4C2O1 |
| InChI | InChI=1S/C18H30O2/c1-6-13-19-12-10-16(2,3)18-8-7-11(9-18)17(4,5)15(18)14(12)20-13/h11-15H,6-10H2,1-5H3/t11-,12?,13?,14?,15?,18-/m0/s1 |
| InChIKey | KVOFYVXLVBHGLQ-PORQETAESA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |