C82H50N6Os — CID 170925486
osmium;bis(4-(4-perylen-3-ylphenyl)-2,6-dipyridin-2-ylpyridine) (PubChem CID 170925486) has the molecular formula C82H50N6Os and a molecular weight of 1309.57 g/mol. Its IUPAC name is osmium;bis(4-(4-perylen-3-ylphenyl)-2,6-dipyridin-2-ylpyridine).
| Compound Name | osmium;bis(4-(4-perylen-3-ylphenyl)-2,6-dipyridin-2-ylpyridine) |
|---|---|
| PubChem CID | 170925486 |
| Molecular Formula | C82H50N6Os |
| Molecular Weight | 1309.57 g/mol |
| Exact Mass | 1310.37 |
| IUPAC Name | osmium;bis(4-(4-perylen-3-ylphenyl)-2,6-dipyridin-2-ylpyridine) |
| SMILES | [Os].c1ccc(-c2cc(-c3ccc(-c4ccc5c6cccc7cccc(c8cccc4c85)c76)cc3)cc(-c3ccccn3)n2)nc1.c1ccc(-c2cc(-c3ccc(-c4ccc5c6cccc7cccc(c8cccc4c85)c76)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/2C41H25N3.Os/c2*1-3-22-42-36(14-1)38-24-29(25-39(44-38)37-15-2-4-23-43-37)26-16-18-27(19-17-26)30-20-21-35-33-11-6-9-28-8-5-10-32(40(28)33)34-13-7-12-31(30)41(34)35;/h2*1-25H; |
| InChIKey | DAJKBWZXJJAIOJ-UHFFFAOYSA-N |
| XLogP | 21.18 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1309.57 |
| LogP ≤ 5 | 21.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|