C12H10ClF3N2O4S — CID 170925737
(4-chloro-3-cyano-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl) trifluoromethanesulfonate (PubChem CID 170925737) has the molecular formula C12H10ClF3N2O4S and a molecular weight of 370.74 g/mol. Its IUPAC name is (4-chloro-3-cyano-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl) trifluoromethanesulfonate.
| Compound Name | (4-chloro-3-cyano-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170925737 |
| Molecular Formula | C12H10ClF3N2O4S |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | (4-chloro-3-cyano-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)Cc2nc(OS(=O)(=O)C(F)(F)F)c(C#N)c(Cl)c2CO1 |
| InChI | InChI=1S/C12H10ClF3N2O4S/c1-11(2)3-8-7(5-21-11)9(13)6(4-17)10(18-8)22-23(19,20)12(14,15)16/h3,5H2,1-2H3 |
| InChIKey | JPGVUJYUTMNXFJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|