C14H27NO2 — CID 170926000
(3S)-3-methoxy-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine (PubChem CID 170926000) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (3S)-3-methoxy-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine.
| Compound Name | (3S)-3-methoxy-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine |
|---|---|
| PubChem CID | 170926000 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (3S)-3-methoxy-1-[[1-(propan-2-yloxymethyl)cyclopropyl]methyl]piperidine |
| SMILES | CO[C@H]1CCCN(CC2(COC(C)C)CC2)C1 |
| InChI | InChI=1S/C14H27NO2/c1-12(2)17-11-14(6-7-14)10-15-8-4-5-13(9-15)16-3/h12-13H,4-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | PUDFNMKLCYTXPG-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |