C48H37N3Si — CID 170927930
2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-4-(9,9-dimethylfluoren-4-yl)-6-(4-naphthalen-2-ylphenyl)-1,3,5-triazine (PubChem CID 170927930) has the molecular formula C48H37N3Si and a molecular weight of 683.93 g/mol. Its IUPAC name is 2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-4-(9,9-dimethylfluoren-4-yl)-6-(4-naphthalen-2-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-4-(9,9-dimethylfluoren-4-yl)-6-(4-naphthalen-2-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170927930 |
| Molecular Formula | C48H37N3Si |
| Molecular Weight | 683.93 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | 2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-4-(9,9-dimethylfluoren-4-yl)-6-(4-naphthalen-2-ylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2c(-c3nc(-c4ccc(-c5ccc6ccccc6c5)cc4)nc(-c4ccc5c(c4)-c4ccccc4[Si]5(C)C)n3)cccc21 |
| InChI | InChI=1S/C48H37N3Si/c1-48(2)40-17-9-7-15-37(40)44-38(16-11-18-41(44)48)47-50-45(32-23-20-31(21-24-32)34-25-22-30-12-5-6-13-33(30)28-34)49-46(51-47)35-26-27-43-39(29-35)36-14-8-10-19-42(36)52(43,3)4/h5-29H,1-4H3 |
| InChIKey | FNPLPSBHBGOIGS-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.93 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|