C18H30N2 — CID 170928108
(4aE)-1,4-ditert-butyl-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine (PubChem CID 170928108) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is (4aE)-1,4-ditert-butyl-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine.
| Compound Name | (4aE)-1,4-ditert-butyl-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 170928108 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | (4aE)-1,4-ditert-butyl-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine |
| SMILES | CC(C)(C)C1=NN=C(C(C)(C)C)C2CCCCC/C=C/12 |
| InChI | InChI=1S/C18H30N2/c1-17(2,3)15-13-11-9-7-8-10-12-14(13)16(20-19-15)18(4,5)6/h11,14H,7-10,12H2,1-6H3/b13-11+ |
| InChIKey | VSDFJRJEHGCNAM-ACCUITESSA-N |
| XLogP | 5.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |