C20H23ClF2N6O8S — CID 170928650
(2S,3R,6R)-4-azido-2-[(2S,4S,5R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 170928650) has the molecular formula C20H23ClF2N6O8S and a molecular weight of 580.95 g/mol. Its IUPAC name is (2S,3R,6R)-4-azido-2-[(2S,4S,5R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2S,3R,6R)-4-azido-2-[(2S,4S,5R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 170928650 |
| Molecular Formula | C20H23ClF2N6O8S |
| Molecular Weight | 580.95 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | (2S,3R,6R)-4-azido-2-[(2S,4S,5R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | [N-]=[N+]=NC1C(O)[C@@H](CO)O[C@@H](S[C@@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(Cl)c(F)c4)nn3)C2O)[C@@H]1O |
| InChI | InChI=1S/C20H23ClF2N6O8S/c21-12-7(22)1-6(2-8(12)23)9-3-29(28-25-9)14-16(33)11(5-31)37-20(18(14)35)38-19-17(34)13(26-27-24)15(32)10(4-30)36-19/h1-3,10-11,13-20,30-35H,4-5H2/t10-,11?,13?,14+,15?,16+,17-,18?,19+,20+/m1/s1 |
| InChIKey | GWGABMVKDRZHPA-AOXXFZCMSA-N |
| XLogP | -0.29 |
| TPSA | 219.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.95 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|