About 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one
4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one (PubChem CID 170928924) has the molecular formula C17H14Cl2N4O3
and a molecular weight of 393.23 g/mol. Its IUPAC name is 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one.
Molecular Properties
| Compound Name | 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one |
| PubChem CID | 170928924 |
| Molecular Formula | C17H14Cl2N4O3 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one |
| SMILES | O=c1ccc2c(cnn2-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1C1CCCC1 |
| InChI | InChI=1S/C17H14Cl2N4O3/c18-12-7-11(23(25)26)8-13(19)17(12)22-14-5-6-16(24)21(15(14)9-20-22)10-3-1-2-4-10/h5-10H,1-4H2 |
| InChIKey | UENKSLHLQKYGAH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one?
The IUPAC name of 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one (CID 170928924) is 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one.
What is the SMILES notation for 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one?
The canonical SMILES for 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one is O=c1ccc2c(cnn2-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1C1CCCC1.
What is the InChIKey of 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one?
The InChIKey is UENKSLHLQKYGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N4O3/c18-12-7-11(23(25)26)8-13(19)17(12)22-14-5-6-16(24)21(15(14)9-20-22)10-3-1-2-4-10/h5-10H,1-4H2.
What are the key properties of 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one?
4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one has a molecular weight of 393.23 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-1-(2,6-dichloro-4-nitrophenyl)pyrazolo[4,5-b]pyridin-5-one is sourced from PubChem (CID 170928924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).