C22H12Cl2N6O4 — CID 170928941
2-[3,5-dichloro-4-[4-(furan-2-ylmethyl)-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione (PubChem CID 170928941) has the molecular formula C22H12Cl2N6O4 and a molecular weight of 495.28 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-(furan-2-ylmethyl)-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[4-(furan-2-ylmethyl)-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 170928941 |
| Molecular Formula | C22H12Cl2N6O4 |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-(furan-2-ylmethyl)-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
| SMILES | [C-]#[N+]c1nn(-c2cc(Cl)c(-n3ccc4c3ccc(=O)n4Cc3ccco3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H12Cl2N6O4/c1-25-20-21(32)26-22(33)30(27-20)12-9-14(23)19(15(24)10-12)28-7-6-17-16(28)4-5-18(31)29(17)11-13-3-2-8-34-13/h2-10H,11H2,(H,26,32,33) |
| InChIKey | HJZQJQXIRPMXOC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|