C23H11Cl2F2N7O3 — CID 170928987
2-[3,5-dichloro-4-[4-[(2,4-difluorophenyl)methyl]-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione (PubChem CID 170928987) has the molecular formula C23H11Cl2F2N7O3 and a molecular weight of 542.29 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-[(2,4-difluorophenyl)methyl]-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[4-[(2,4-difluorophenyl)methyl]-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 170928987 |
| Molecular Formula | C23H11Cl2F2N7O3 |
| Molecular Weight | 542.29 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-[(2,4-difluorophenyl)methyl]-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
| SMILES | [C-]#[N+]c1nn(-c2cc(Cl)c(-n3ncc4c3ccc(=O)n4Cc3ccc(F)cc3F)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H11Cl2F2N7O3/c1-28-21-22(36)30-23(37)33(31-21)13-7-14(24)20(15(25)8-13)34-17-4-5-19(35)32(18(17)9-29-34)10-11-2-3-12(26)6-16(11)27/h2-9H,10H2,(H,30,36,37) |
| InChIKey | DKTRZFZSZZKAEX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|