About 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one
1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one (PubChem CID 170929065) has the molecular formula C18H18Cl2N4O
and a molecular weight of 377.28 g/mol. Its IUPAC name is 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one.
Molecular Properties
| Compound Name | 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one |
| PubChem CID | 170929065 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one |
| SMILES | Nc1cc(Cl)c(-n2ncc3c2ccc(=O)n3C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N4O/c19-13-8-11(21)9-14(20)18(13)24-15-6-7-17(25)23(16(15)10-22-24)12-4-2-1-3-5-12/h6-10,12H,1-5,21H2 |
| InChIKey | IBJAPHOPPKGYGH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one?
The IUPAC name of 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one (CID 170929065) is 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one.
What is the SMILES notation for 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one?
The canonical SMILES for 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one is Nc1cc(Cl)c(-n2ncc3c2ccc(=O)n3C2CCCCC2)c(Cl)c1.
What is the InChIKey of 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one?
The InChIKey is IBJAPHOPPKGYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N4O/c19-13-8-11(21)9-14(20)18(13)24-15-6-7-17(25)23(16(15)10-22-24)12-4-2-1-3-5-12/h6-10,12H,1-5,21H2.
What are the key properties of 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one?
1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one has a molecular weight of 377.28 g/mol, XLogP of 4.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-2,6-dichlorophenyl)-4-cyclohexylpyrazolo[4,5-b]pyridin-5-one is sourced from PubChem (CID 170929065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).