C22H13Cl2N7O4 — CID 170929107
2-[3,5-dichloro-4-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione (PubChem CID 170929107) has the molecular formula C22H13Cl2N7O4 and a molecular weight of 510.30 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 170929107 |
| Molecular Formula | C22H13Cl2N7O4 |
| Molecular Weight | 510.30 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-oxopyrrolo[3,2-b]pyridin-1-yl]phenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
| SMILES | [C-]#[N+]c1nn(-c2cc(Cl)c(-n3ccc4c3ccc(=O)n4Cc3cc(C)on3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H13Cl2N7O4/c1-11-7-12(28-35-11)10-30-17-5-6-29(16(17)3-4-18(30)32)19-14(23)8-13(9-15(19)24)31-22(34)26-21(33)20(25-2)27-31/h3-9H,10H2,1H3,(H,26,33,34) |
| InChIKey | RYXUUDWFHLKEML-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|