C24H23Cl2N7O4 — CID 170929109
ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(4-cyclohexyl-5-oxopyrazolo[4,5-b]pyridin-1-yl)phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 170929109) has the molecular formula C24H23Cl2N7O4 and a molecular weight of 544.40 g/mol. Its IUPAC name is ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(4-cyclohexyl-5-oxopyrazolo[4,5-b]pyridin-1-yl)phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(4-cyclohexyl-5-oxopyrazolo[4,5-b]pyridin-1-yl)phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 170929109 |
| Molecular Formula | C24H23Cl2N7O4 |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-(4-cyclohexyl-5-oxopyrazolo[4,5-b]pyridin-1-yl)phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N\Nc1cc(Cl)c(-n2ncc3c2ccc(=O)n3C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C24H23Cl2N7O4/c1-2-37-24(36)29-23(35)18(12-27)31-30-14-10-16(25)22(17(26)11-14)33-19-8-9-21(34)32(20(19)13-28-33)15-6-4-3-5-7-15/h8-11,13,15,30H,2-7H2,1H3,(H,29,35,36)/b31-18- |
| InChIKey | UPXPPTORHOISSK-MNBJERMJSA-N |
| XLogP | 4.56 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|