C25H25Cl2N7O4 — CID 170929146
ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[4-(cyclohexylmethyl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 170929146) has the molecular formula C25H25Cl2N7O4 and a molecular weight of 558.43 g/mol. Its IUPAC name is ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[4-(cyclohexylmethyl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[4-(cyclohexylmethyl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 170929146 |
| Molecular Formula | C25H25Cl2N7O4 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | ethyl N-[(2Z)-2-cyano-2-[[3,5-dichloro-4-[4-(cyclohexylmethyl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N\Nc1cc(Cl)c(-n2ncc3c2ccc(=O)n3CC2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C25H25Cl2N7O4/c1-2-38-25(37)30-24(36)19(12-28)32-31-16-10-17(26)23(18(27)11-16)34-20-8-9-22(35)33(21(20)13-29-34)14-15-6-4-3-5-7-15/h8-11,13,15,31H,2-7,14H2,1H3,(H,30,36,37)/b32-19- |
| InChIKey | RPJMRVGUJNKXIW-MZFJOGFUSA-N |
| XLogP | 4.64 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|